Difference between revisions of "N-FORMIMINO-L-GLUTAMATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONATE-15-LIPOXYGENASE-RXN ARACHIDONATE-15-LIPOXYGENASE-RXN] == * direction: ** left-to-right...")
(Created page with "Category:metabolite == Metabolite CPD-196 == * common-name: ** octanoyl-coa * smiles: ** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ARACHIDONATE-15-LIPOXYGENASE-RXN ARACHIDONATE-15-LIPOXYGENASE-RXN] ==
+
== Metabolite CPD-196 ==
* direction:
+
* common-name:
** left-to-right
+
** octanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.13.11.33 ec-1.13.11.33]
+
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[ARACHIDONIC_ACID]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[5Z8Z11Z13E-15S-15-HYDROPEROXYICOS]][c]
+
** kqmzyoxobsxmii-cecatxlmsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ05858]]
+
** 889.7
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
* Gene: [[SJ08276]]
+
* [[ACACT4]]
** Category: [[annotation]]
+
* [[ACACT4h]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
* Gene: [[SJ21859]]
+
* [[ACOA80OR]]
** Category: [[annotation]]
+
* [[RXN-12669]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14229]]
* Gene: [[SJ21863]]
+
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ACACT4]]
== Pathway(s) ==
+
* [[R223-RXN]]
== Reconstruction information  ==
+
* [[RXN-13617]]
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14229]]
== External links  ==
+
== Reaction(s) of unknown directionality ==
* RHEA:
+
{{#set: common-name=octanoyl-coa}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16870 16870]
+
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
* LIGAND-RXN:
+
{{#set: molecular-weight=889.7}}
** [http://www.genome.jp/dbget-bin/www_bget?R01593 R01593]
 
* UNIPROT:
 
** [http://www.uniprot.org/uniprot/P16050 P16050]
 
** [http://www.uniprot.org/uniprot/P12530 P12530]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.13.11.33}}
 
{{#set: nb gene associated=4}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-196

  • common-name:
    • octanoyl-coa
  • smiles:
    • cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kqmzyoxobsxmii-cecatxlmsa-j
  • molecular-weight:
    • 889.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality