Difference between revisions of "N-FORMYLKYNURENINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12826 == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD-8606 == * common-name: ** 24,25-dihydrolanosterol * smiles: ** cc(c)cccc([ch]4(c1(c)(c(c)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8606 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 24,25-dihydrolanosterol |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)cccc([ch]4(c1(c)(c(c)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mbzykevpfyhdoh-bqniitsrsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 428.74 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-13707]] |
| − | * [[ | + | * [[RXN66-11]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=24,25-dihydrolanosterol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mbzykevpfyhdoh-bqniitsrsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=428.74}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite CPD-8606
- common-name:
- 24,25-dihydrolanosterol
- smiles:
- cc(c)cccc([ch]4(c1(c)(c(c)(c2(=c(cc1)c3(c)([ch](cc2)c(c)(c)c(o)cc3)))cc4)))c
- inchi-key:
- mbzykevpfyhdoh-bqniitsrsa-n
- molecular-weight:
- 428.74
