Difference between revisions of "N-FORMYLKYNURENINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13851 == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)...")
(Created page with "Category:metabolite == Metabolite N-FORMYLKYNURENINE == * common-name: ** n-formylkynurenine * smiles: ** [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-]) * inchi-key: ** byhj...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13851 ==
+
== Metabolite N-FORMYLKYNURENINE ==
 
* common-name:
 
* common-name:
** 2-hydroxy-datp
+
** n-formylkynurenine
 
* smiles:
 
* smiles:
** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
+
** [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** uoacbprdwrdehj-kvqbguixsa-j
+
** byhjhxptqmmkca-qmmmgpobsa-n
 
* molecular-weight:
 
* molecular-weight:
** 503.152
+
** 236.227
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6957]]
+
* [[ARYLFORMAMIDASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8665]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-datp}}
+
{{#set: common-name=n-formylkynurenine}}
{{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}}
+
{{#set: inchi-key=inchikey=byhjhxptqmmkca-qmmmgpobsa-n}}
{{#set: molecular-weight=503.152}}
+
{{#set: molecular-weight=236.227}}

Latest revision as of 11:17, 18 March 2021

Metabolite N-FORMYLKYNURENINE

  • common-name:
    • n-formylkynurenine
  • smiles:
    • [ch](=o)nc1(c=cc=cc=1c(=o)cc([n+])c(=o)[o-])
  • inchi-key:
    • byhjhxptqmmkca-qmmmgpobsa-n
  • molecular-weight:
    • 236.227

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality