Difference between revisions of "N-SUCCINYL-2-AMINO-6-KETOPIMELATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ13638 == * transcription-direction: ** negative * right-end-position: ** 156614 * left-end-position: ** 137659 * centisome-position: ** 41.462055...") |
(Created page with "Category:metabolite == Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE == * common-name: ** n-succinyl-2-amino-6-ketopimelate * smiles: ** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o...") |
||
(9 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE == |
− | * | + | * common-name: |
− | ** | + | ** n-succinyl-2-amino-6-ketopimelate |
− | * | + | * smiles: |
− | ** | + | ** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o |
− | * | + | * inchi-key: |
− | ** | + | ** sdvxscsnvvzwdd-lurjtmiesa-k |
− | * | + | * molecular-weight: |
− | ** | + | ** 286.218 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[SUCCINYLDIAMINOPIMTRANS-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=n-succinyl-2-amino-6-ketopimelate}} | |
− | + | {{#set: inchi-key=inchikey=sdvxscsnvvzwdd-lurjtmiesa-k}} | |
− | + | {{#set: molecular-weight=286.218}} | |
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE
- common-name:
- n-succinyl-2-amino-6-ketopimelate
- smiles:
- c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
- inchi-key:
- sdvxscsnvvzwdd-lurjtmiesa-k
- molecular-weight:
- 286.218