Difference between revisions of "N-SUCCINYL-2-AMINO-6-KETOPIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-606 == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] * inchi-ke...")
(Created page with "Category:metabolite == Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE == * common-name: ** n-succinyl-2-amino-6-ketopimelate * smiles: ** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-606 ==
+
== Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE ==
 
* common-name:
 
* common-name:
−
** cdp-glycerol
+
** n-succinyl-2-amino-6-ketopimelate
 
* smiles:
 
* smiles:
−
** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
+
** c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** hhpouccvoneprk-jbsykwbfsa-l
+
** sdvxscsnvvzwdd-lurjtmiesa-k
 
* molecular-weight:
 
* molecular-weight:
−
** 475.242
+
** 286.218
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=cdp-glycerol}}
+
{{#set: common-name=n-succinyl-2-amino-6-ketopimelate}}
−
{{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}}
+
{{#set: inchi-key=inchikey=sdvxscsnvvzwdd-lurjtmiesa-k}}
−
{{#set: molecular-weight=475.242}}
+
{{#set: molecular-weight=286.218}}

Latest revision as of 11:14, 18 March 2021

Metabolite N-SUCCINYL-2-AMINO-6-KETOPIMELATE

  • common-name:
    • n-succinyl-2-amino-6-ketopimelate
  • smiles:
    • c(cc(=o)c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
  • inchi-key:
    • sdvxscsnvvzwdd-lurjtmiesa-k
  • molecular-weight:
    • 286.218

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-SUCCINYL-2-AMINO-6-KETOPIMELATE&oldid=138087"