Difference between revisions of "N-SUCCINYL-2-AMINO-6-KETOPIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-606 == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-] * inchi-ke...")
(Created page with "Category:metabolite == Metabolite CPD-19147 == * common-name: ** (7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-606 ==
+
== Metabolite CPD-19147 ==
 
* common-name:
 
* common-name:
** cdp-glycerol
+
** (7z)-tetradecenoyl-coa
 
* smiles:
 
* smiles:
** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
+
** ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** hhpouccvoneprk-jbsykwbfsa-l
+
** jpihvkickvpffy-twafkmgksa-j
 
* molecular-weight:
 
* molecular-weight:
** 475.242
+
** 971.845
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[RXN-17792]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[RXN-17791]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cdp-glycerol}}
+
{{#set: common-name=(7z)-tetradecenoyl-coa}}
{{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}}
+
{{#set: inchi-key=inchikey=jpihvkickvpffy-twafkmgksa-j}}
{{#set: molecular-weight=475.242}}
+
{{#set: molecular-weight=971.845}}

Revision as of 18:55, 14 January 2021

Metabolite CPD-19147

  • common-name:
    • (7z)-tetradecenoyl-coa
  • smiles:
    • ccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • jpihvkickvpffy-twafkmgksa-j
  • molecular-weight:
    • 971.845

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality