Difference between revisions of "N-SUCCINYLLL-2-6-DIAMINOPIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09885 == * transcription-direction: ** negative * right-end-position: ** 271639 * left-end-position: ** 264812 * centisome-position: ** 65.47054...")
(Created page with "Category:metabolite == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == * common-name: ** n-succinyl-l,l-2,6-diaminopimelate * smiles: ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09885 ==
+
== Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** n-succinyl-l,l-2,6-diaminopimelate
−
* right-end-position:
+
* smiles:
−
** 271639
+
** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 264812
+
** glxuwzbupatpbr-bqbzgakwsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 65.47054   
+
** 288.257
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ATPASE-RXN]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=288.257}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=271639}}
 
−
{{#set: left-end-position=264812}}
 
−
{{#set: centisome-position=65.47054    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE

  • common-name:
    • n-succinyl-l,l-2,6-diaminopimelate
  • smiles:
    • c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
  • inchi-key:
    • glxuwzbupatpbr-bqbzgakwsa-l
  • molecular-weight:
    • 288.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-SUCCINYLLL-2-6-DIAMINOPIMELATE&oldid=138012"