Difference between revisions of "N-SUCCINYLLL-2-6-DIAMINOPIMELATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLC-1-P == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: ** h...")
(Created page with "Category:metabolite == Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE == * common-name: ** n-succinyl-l,l-2,6-diaminopimelate * smiles: ** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite GLC-1-P ==
+
== Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE ==
 
* common-name:
 
* common-name:
−
** α-d-glucopyranose 1-phosphate
+
** n-succinyl-l,l-2,6-diaminopimelate
 
* smiles:
 
* smiles:
−
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
 
* inchi-key:
 
* inchi-key:
−
** hxxfsfrbohsimq-vfuothlcsa-l
+
** glxuwzbupatpbr-bqbzgakwsa-l
 
* molecular-weight:
 
* molecular-weight:
−
** 258.121
+
** 288.257
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
−
* [[GLUC1PURIDYLTRANS-RXN]]
 
−
* [[PGCM]]
 
−
* [[PGMTh]]
 
−
* [[PHOSPHOGLUCMUT-RXN]]
 
−
* [[RXN-12486]]
 
−
* [[RXN-16997]]
 
−
* [[RXN4FS-13]]
 
−
* [[UG1PUT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[SUCCINYLDIAMINOPIMTRANS-RXN]]
−
* [[GLUC1PURIDYLTRANS-RXN]]
 
−
* [[GLYCOPHOSPHORYL-RXN]]
 
−
* [[GLYMALTOPHOSPHORYL-RXN]]
 
−
* [[PGCM]]
 
−
* [[PGMTh]]
 
−
* [[PHOSPHOGLUCMUT-RXN]]
 
−
* [[RXN-12171]]
 
−
* [[RXN-12392]]
 
−
* [[RXN-12486]]
 
−
* [[RXN-14284]]
 
−
* [[RXN-14285]]
 
−
* [[RXN-14286]]
 
−
* [[RXN-14353]]
 
−
* [[RXN-1826]]
 
−
* [[RXN-9025]]
 
−
* [[RXN0-5182]]
 
−
* [[RXN0-5184]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
+
{{#set: common-name=n-succinyl-l,l-2,6-diaminopimelate}}
−
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
+
{{#set: inchi-key=inchikey=glxuwzbupatpbr-bqbzgakwsa-l}}
−
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=288.257}}

Latest revision as of 11:14, 18 March 2021

Metabolite N-SUCCINYLLL-2-6-DIAMINOPIMELATE

  • common-name:
    • n-succinyl-l,l-2,6-diaminopimelate
  • smiles:
    • c(cc([n+])c(=o)[o-])cc(nc(ccc([o-])=o)=o)c([o-])=o
  • inchi-key:
    • glxuwzbupatpbr-bqbzgakwsa-l
  • molecular-weight:
    • 288.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-SUCCINYLLL-2-6-DIAMINOPIMELATE&oldid=138012"