Difference between revisions of "N-SUCCINYLLL-2-6-DIAMINOPIMELATE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00403 == * transcription-direction: ** positive * right-end-position: ** 466328 * left-end-position: ** 459419 * centisome-position: ** 80.90328...") |
(Created page with "Category:metabolite == Metabolite 2-PG == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-])co * inchi-key: ** gxiurptvhjpjlf-uwtatzphsa-k...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 2-PG == |
− | * | + | * common-name: |
− | ** | + | ** 2-phospho-d-glycerate |
− | * | + | * smiles: |
− | ** | + | ** c(=o)([o-])c(op(=o)([o-])[o-])co |
− | * | + | * inchi-key: |
− | ** | + | ** gxiurptvhjpjlf-uwtatzphsa-k |
− | * | + | * molecular-weight: |
− | ** | + | ** 183.034 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[2PGADEHYDRAT-RXN]] |
− | + | * [[3PGAREARR-RXN]] | |
− | * [[RXN | + | * [[RXN-15510]] |
− | * | + | * [[RXN-15513]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[2PGADEHYDRAT-RXN]] | |
− | * | + | * [[3PGAREARR-RXN]] |
− | * [[ | + | * [[RXN-15510]] |
− | * | + | * [[RXN-15513]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | == | + | {{#set: common-name=2-phospho-d-glycerate}} |
− | + | {{#set: inchi-key=inchikey=gxiurptvhjpjlf-uwtatzphsa-k}} | |
− | + | {{#set: molecular-weight=183.034}} | |
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite 2-PG
- common-name:
- 2-phospho-d-glycerate
- smiles:
- c(=o)([o-])c(op(=o)([o-])[o-])co
- inchi-key:
- gxiurptvhjpjlf-uwtatzphsa-k
- molecular-weight:
- 183.034