Difference between revisions of "N-Substituted-Aminoacyl-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-316 == * common-name: ** reduced riboflavin * smiles: ** cc1(=c(c=c2(c(=c1)nc3(c(n2cc(o)c(o)c(o)co)=nc(nc3=o)=o)))c) * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite N-Substituted-Aminoacyl-tRNA == * common-name: ** an n-modified aminoacyl-[trna] == Reaction(s) known to consume the compound == * AMIN...") |
||
| (4 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-Substituted-Aminoacyl-tRNA == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-modified aminoacyl-[trna] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[AMINOCYL-TRNA-HYDROLASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-modified aminoacyl-[trna]}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite N-Substituted-Aminoacyl-tRNA
- common-name:
- an n-modified aminoacyl-[trna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-modified aminoacyl-[trna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
