Difference between revisions of "N-Substituted-Aminoacyl-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19339 == * common-name: ** α-d-sedoheptulopyranose 7-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)c(co)(o)o1) * inc...") |
(Created page with "Category:metabolite == Metabolite N-Substituted-Aminoacyl-tRNA == * common-name: ** an n-modified aminoacyl-[trna] == Reaction(s) known to consume the compound == * AMIN...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N-Substituted-Aminoacyl-tRNA == |
* common-name: | * common-name: | ||
− | ** | + | ** an n-modified aminoacyl-[trna] |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[AMINOCYL-TRNA-HYDROLASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an n-modified aminoacyl-[trna]}} |
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite N-Substituted-Aminoacyl-tRNA
- common-name:
- an n-modified aminoacyl-[trna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-modified aminoacyl-[trna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.