Difference between revisions of "N-TETRADECANOYLGLYCYL-PEPTIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-PHE-tRNAs == * common-name: ** an l-phenylalanyl-[trnaphe] == Reaction(s) known to consume the compound == == Reaction(s) known t...") |
(Created page with "Category:metabolite == Metabolite ISOPHENOXAZINE == * common-name: ** isophenoxazine * smiles: ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) * inchi-key: ** rdjxpxhqenrcn...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ISOPHENOXAZINE == |
* common-name: | * common-name: | ||
− | ** | + | ** isophenoxazine |
+ | * smiles: | ||
+ | ** c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n))) | ||
+ | * inchi-key: | ||
+ | ** rdjxpxhqenrcng-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 212.207 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[O-AMINOPHENOL-OXIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=isophenoxazine}} |
+ | {{#set: inchi-key=inchikey=rdjxpxhqenrcng-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=212.207}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite ISOPHENOXAZINE
- common-name:
- isophenoxazine
- smiles:
- c1(c=cc2(=c(c=1)n=c3(c=c(c(=o)c=c(o2)3)n)))
- inchi-key:
- rdjxpxhqenrcng-uhfffaoysa-n
- molecular-weight:
- 212.207