Difference between revisions of "N-acetyl-D-galactosamine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14968 == * transcription-direction: ** positive * right-end-position: ** 256741 * left-end-position: ** 244890 * centisome-position: ** 80.52758...")
(Created page with "Category:metabolite == Metabolite CPD-11875 == * common-name: ** normetanephrine * smiles: ** coc1(=c(o)c=cc(c(o)c[n+])=c1) * inchi-key: ** ynyaywlbahxhll-qmmmgpobsa-o * m...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14968 ==
+
== Metabolite CPD-11875 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** normetanephrine
−
* right-end-position:
+
* smiles:
−
** 256741
+
** coc1(=c(o)c=cc(c(o)c[n+])=c1)
−
* left-end-position:
+
* inchi-key:
−
** 244890
+
** ynyaywlbahxhll-qmmmgpobsa-o
−
* centisome-position:
+
* molecular-weight:
−
** 80.52758   
+
** 184.214
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10910]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=normetanephrine}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ynyaywlbahxhll-qmmmgpobsa-o}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=184.214}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6773]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=256741}}
 
−
{{#set: left-end-position=244890}}
 
−
{{#set: centisome-position=80.52758    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=1}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-11875

  • common-name:
    • normetanephrine
  • smiles:
    • coc1(=c(o)c=cc(c(o)c[n+])=c1)
  • inchi-key:
    • ynyaywlbahxhll-qmmmgpobsa-o
  • molecular-weight:
    • 184.214

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=N-acetyl-D-galactosamine&oldid=47136"