Difference between revisions of "N-acetyl-D-glucosamine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-IDONATE == * common-name: ** l-idonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] * inchi-key: ** rghnjxzeokukbd-sknvomklsa-m * molecul...") |
(Created page with "Category:metabolite == Metabolite N-acetyl-D-glucosamine == * common-name: ** n-acetyl-d-glucosamine == Reaction(s) known to consume the compound == * N-ACETYLLACTOSAMIN...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-acetyl-D-glucosamine == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-d-glucosamine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12625]] | ||
| + | * [[RXN-16485]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-d-glucosamine}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite N-acetyl-D-glucosamine
- common-name:
- n-acetyl-d-glucosamine
