Difference between revisions of "N-acetyl-D-glucosamine-asparagine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...") |
(Created page with "Category:metabolite == Metabolite CPD1F-120 == * common-name: ** gibberellin a24 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD1F-120 == |
* common-name: | * common-name: | ||
− | ** | + | ** gibberellin a24 |
* smiles: | * smiles: | ||
− | ** c1( | + | ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** qqrsshfhxysomf-cxxojbqzsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 344.407 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN1F-163]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=gibberellin a24}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=qqrsshfhxysomf-cxxojbqzsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=344.407}} |
Revision as of 11:16, 15 January 2021
Contents
Metabolite CPD1F-120
- common-name:
- gibberellin a24
- smiles:
- c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
- inchi-key:
- qqrsshfhxysomf-cxxojbqzsa-l
- molecular-weight:
- 344.407