Difference between revisions of "N-acetyl-D-glucosamine-asparagine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-L-MYO-INOSITOL-1-P == * common-name: ** 1d-myo-inositol 3-monophosphate * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * inch...")
(Created page with "Category:metabolite == Metabolite CPD1F-120 == * common-name: ** gibberellin a24 * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-L-MYO-INOSITOL-1-P ==
+
== Metabolite CPD1F-120 ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 3-monophosphate
+
** gibberellin a24
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** inapmgsxuvuwaf-ptqmnwpwsa-l
+
** qqrsshfhxysomf-cxxojbqzsa-l
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 344.407
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
 
* [[RXN-6501]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
* [[RXN1F-163]]
* [[RXN-10960]]
 
* [[RXN66-579]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
+
{{#set: common-name=gibberellin a24}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
+
{{#set: inchi-key=inchikey=qqrsshfhxysomf-cxxojbqzsa-l}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=344.407}}

Revision as of 11:16, 15 January 2021

Metabolite CPD1F-120

  • common-name:
    • gibberellin a24
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c=o)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
  • inchi-key:
    • qqrsshfhxysomf-cxxojbqzsa-l
  • molecular-weight:
    • 344.407

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality