Difference between revisions of "N-acetyl-D-glucosamine-asparagine"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00010 == * transcription-direction: ** positive * right-end-position: ** 235660 * left-end-position: ** 232895 * centisome-position: ** 15.853389...") |
(Created page with "Category:metabolite == Metabolite CPD-591 == * common-name: ** cyanidin * smiles: ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) * inchi-key: ** vevzs...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-591 == |
| − | * | + | * common-name: |
| − | ** | + | ** cyanidin |
| − | * | + | * smiles: |
| − | ** | + | ** c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** vevzsmaejfvwil-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 285.232 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9725]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=cyanidin}} | |
| − | + | {{#set: inchi-key=inchikey=vevzsmaejfvwil-uhfffaoysa-m}} | |
| − | {{#set: | + | {{#set: molecular-weight=285.232}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-591
- common-name:
- cyanidin
- smiles:
- c3(c(c1(c(=cc2(=c([o-])c=c(o)c=c([o+]=1)2))[o-]))=cc(o)=c(c=3)o)
- inchi-key:
- vevzsmaejfvwil-uhfffaoysa-m
- molecular-weight:
- 285.232
