Difference between revisions of "N-methyl-terminal-XPK"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-653 == * common-name: ** (s)-nadhx * smiles: ** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34...")
(Created page with "Category:metabolite == Metabolite N-methyl-terminal-XPK == * common-name: ** an n terminal n-methyl-(a/s)pk-[protein] == Reaction(s) known to consume the compound == * R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-653 ==
+
== Metabolite N-methyl-terminal-XPK ==
 
* common-name:
 
* common-name:
** (s)-nadhx
+
** an n terminal n-methyl-(a/s)pk-[protein]
* smiles:
 
** c1(=c(ccc(o)n1c5(oc(cop(=o)([o-])op(=o)([o-])occ2(oc(c(o)c(o)2)n4(c=nc3(c(n)=nc=nc=34))))c(o)c(o)5))c(n)=o)
 
* inchi-key:
 
** idbzkgqrlbfufq-vphrtnkssa-l
 
* molecular-weight:
 
** 681.445
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4.2.1.93-RXN]]
+
* [[RXN-12890]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12752]]
+
* [[RXN-12889]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-nadhx}}
+
{{#set: common-name=an n terminal n-methyl-(a/s)pk-[protein]}}
{{#set: inchi-key=inchikey=idbzkgqrlbfufq-vphrtnkssa-l}}
 
{{#set: molecular-weight=681.445}}
 

Revision as of 14:57, 5 January 2021

Metabolite N-methyl-terminal-XPK

  • common-name:
    • an n terminal n-methyl-(a/s)pk-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n terminal n-methyl-(a/s)pk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.