Difference between revisions of "N-terminal-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ02536 == * transcription-direction: ** negative * right-end-position: ** 21818 * left-end-position: ** 1177 * centisome-position: ** 0.882084 =...") |
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite N-ALPHA-ACETYLORNITHINE == |
− | * | + | * common-name: |
− | ** | + | ** n-acetyl-l-ornithine |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)nc(ccc[n+])c(=o)[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** jrlgpaxaghmnol-lurjtmiesa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 174.199 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[ACETYLORNDEACET-RXN]] | |
− | == Reaction(s) | + | * [[ACETYLORNTRANSAM-RXN]] |
− | * [[ | + | * [[AODAA]] |
− | * | + | * [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[ACETYLORNDEACET-RXN]] |
− | + | * [[ACETYLORNTRANSAM-RXN]] | |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=n-acetyl-l-ornithine}} | |
− | + | {{#set: inchi-key=inchikey=jrlgpaxaghmnol-lurjtmiesa-n}} | |
− | + | {{#set: molecular-weight=174.199}} | |
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 20:33, 18 December 2020
Contents
Metabolite N-ALPHA-ACETYLORNITHINE
- common-name:
- n-acetyl-l-ornithine
- smiles:
- cc(=o)nc(ccc[n+])c(=o)[o-]
- inchi-key:
- jrlgpaxaghmnol-lurjtmiesa-n
- molecular-weight:
- 174.199