Difference between revisions of "N-terminal-L-Serine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-PG == * common-name: ** 2-phospho-d-glycerate * smiles: ** c(=o)([o-])c(op(=o)([o-])[o-])co * inchi-key: ** gxiurptvhjpjlf-uwtatzphsa-k...") |
(Created page with "Category:metabolite == Metabolite N-terminal-L-Serine == * common-name: ** an n-terminal l-seryl-[protein] == Reaction(s) known to consume the compound == == Reaction(s) k...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-terminal-L-Serine == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal l-seryl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-17876]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal l-seryl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite N-terminal-L-Serine
- common-name:
- an n-terminal l-seryl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal l-seryl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
