Difference between revisions of "N-terminal-L-cysteine-sulfinate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4211 == * common-name: ** dimethylallyl diphosphate * smiles: ** cc(c)=ccop(=o)([o-])op(=o)([o-])[o-] * inchi-key: ** cbidrcwhncksto-...") |
(Created page with "Category:metabolite == Metabolite N-terminal-L-cysteine-sulfinate == * common-name: ** an n-terminal 3-sulfino-l-alanyl-[protein] == Reaction(s) known to consume the compo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-terminal-L-cysteine-sulfinate == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-terminal 3-sulfino-l-alanyl-[protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-17890]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-terminal 3-sulfino-l-alanyl-[protein]}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite N-terminal-L-cysteine-sulfinate
- common-name:
- an n-terminal 3-sulfino-l-alanyl-[protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-terminal 3-sulfino-l-alanyl-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
