Difference between revisions of "N-terminal-PPK"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_I == * common-name: ** coproporphyrinogen i * smiles: ** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(c...")
(Created page with "Category:metabolite == Metabolite N-terminal-PPK == * common-name: ** an n-terminal-ppk-[protein] == Reaction(s) known to consume the compound == * RXN-13226 * RXN-1...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite COPROPORPHYRINOGEN_I ==
+
== Metabolite N-terminal-PPK ==
 
* common-name:
 
* common-name:
** coproporphyrinogen i
+
** an n-terminal-ppk-[protein]
* smiles:
 
** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
 
* inchi-key:
 
** wiuggjkhyqignh-uhfffaoysa-j
 
* molecular-weight:
 
** 656.734
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13226]]
 +
* [[RXN-13227]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10642]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen i}}
+
{{#set: common-name=an n-terminal-ppk-[protein]}}
{{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}}
 
{{#set: molecular-weight=656.734}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite N-terminal-PPK

  • common-name:
    • an n-terminal-ppk-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an n-terminal-ppk-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.