Difference between revisions of "N-terminal-PPK"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_I == * common-name: ** coproporphyrinogen i * smiles: ** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(c...")
(Created page with "Category:metabolite == Metabolite METOH == * common-name: ** methanol * smiles: ** co * inchi-key: ** okkjlvbelutlkv-uhfffaoysa-n * molecular-weight: ** 32.042 == Reaction...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite COPROPORPHYRINOGEN_I ==
+
== Metabolite METOH ==
 
* common-name:
 
* common-name:
** coproporphyrinogen i
+
** methanol
 
* smiles:
 
* smiles:
** cc1(=c2(cc5(=c(ccc([o-])=o)c(c)=c(cc4(=c(ccc([o-])=o)c(c)=c(cc3(=c(ccc([o-])=o)c(c)=c(cc(=c(ccc([o-])=o)1)n2)n3))n4))n5)))
+
** co
 
* inchi-key:
 
* inchi-key:
** wiuggjkhyqignh-uhfffaoysa-j
+
** okkjlvbelutlkv-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 656.734
+
** 32.042
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[METHANOL-DEHYDROGENASE-RXN]]
 +
* [[RXN-14189]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10642]]
+
* [[METHANOL-DEHYDROGENASE-RXN]]
 +
* [[RXN-10711]]
 +
* [[RXN-10767]]
 +
* [[RXN-12322]]
 +
* [[RXN-15776]]
 +
* [[RXN-8409]]
 +
* [[RXNQT-4366]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=coproporphyrinogen i}}
+
{{#set: common-name=methanol}}
{{#set: inchi-key=inchikey=wiuggjkhyqignh-uhfffaoysa-j}}
+
{{#set: inchi-key=inchikey=okkjlvbelutlkv-uhfffaoysa-n}}
{{#set: molecular-weight=656.734}}
+
{{#set: molecular-weight=32.042}}

Revision as of 15:25, 5 January 2021

Metabolite METOH

  • common-name:
    • methanol
  • smiles:
    • co
  • inchi-key:
    • okkjlvbelutlkv-uhfffaoysa-n
  • molecular-weight:
    • 32.042

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality