Difference between revisions of "N-terminal-asparagine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9446 == * common-name: ** 1,5-anhydro-d-mannitol * smiles: ** c(o)c1(occ(o)c(o)c(o)1) * inchi-key: ** mpcajmnynogxpb-kvtdhhqdsa-n * m...") |
(Created page with "Category:metabolite == Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- == * common-name: ** udp-β-l-threo-pentapyranos-4-ulose * smiles: ** c3(oc(op(=o)([o-])op(=o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE- == |
* common-name: | * common-name: | ||
| − | ** | + | ** udp-β-l-threo-pentapyranos-4-ulose |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** urjziqltpcjvmw-qnsckltrsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 532.247 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-1863]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-1863]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=udp-β-l-threo-pentapyranos-4-ulose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=urjziqltpcjvmw-qnsckltrsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=532.247}} |
Revision as of 18:54, 14 January 2021
Contents
Metabolite 5-BETA-L-THREO-PENTAPYRANOSYL-4-ULOSE-
- common-name:
- udp-β-l-threo-pentapyranos-4-ulose
- smiles:
- c3(oc(op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))c(o)c(o)c(=o)3)
- inchi-key:
- urjziqltpcjvmw-qnsckltrsa-l
- molecular-weight:
- 532.247
