Difference between revisions of "N-terminal-specific-UCP-E2-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-TRYPTOPHAN == * common-name: ** d-tryptophan * smiles: ** c2(nc1(c=cc=cc=1c(cc([n+])c(=o)[o-])=2)) * inchi-key: ** qivbcdijiajpqs-secbi...") |
(Created page with "Category:metabolite == Metabolite CPD-8594 == * common-name: ** a lewis x epitope == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compo...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8594 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a lewis x epitope |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a lewis x epitope}} |
| − | |||
| − | |||
Revision as of 08:30, 15 March 2021
Contents
Metabolite CPD-8594
- common-name:
- a lewis x epitope
