Difference between revisions of "N-terminal-specific-UCP-E2-L-cysteine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12482 == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) * inchi-key: ** hmlzlhkhnblljd-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite CPD0-2352 == * common-name: ** a trna precursor with a 5' extension and a short 3' extension == Reaction(s) known to consume the compound...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD0-2352 == |
* common-name: | * common-name: | ||
− | ** 3 | + | ** a trna precursor with a 5' extension and a short 3' extension |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[3.1.26.5-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-6479]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3 | + | {{#set: common-name=a trna precursor with a 5' extension and a short 3' extension}} |
− | |||
− |
Revision as of 13:12, 14 January 2021
Contents
Metabolite CPD0-2352
- common-name:
- a trna precursor with a 5' extension and a short 3' extension