Difference between revisions of "N-terminal-specific-UCP-E2-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14715 RXN-14715] == * direction: ** left-to-right * common-name: ** 2-trans,4-trans-tetradecadi...")
(Created page with "Category:metabolite == Metabolite CPD-12482 == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) * inchi-key: ** hmlzlhkhnblljd-uhfffaoys...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14715 RXN-14715] ==
+
== Metabolite CPD-12482 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** 2-trans,4-trans-tetradecadienoyl-coa reductase
+
** 3,7-dimethylurate
** 2,4-dienoyl-coa reductase
+
* smiles:
* ec-number:
+
** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
** [http://enzyme.expasy.org/EC/1.3.1.34 ec-1.3.1.34]
+
* inchi-key:
== Reaction formula ==
+
** hmlzlhkhnblljd-uhfffaoysa-n
* 1 [[CPD-15566]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-15567]][c] '''+''' 1 [[NADP]][c]
+
* molecular-weight:
== Gene(s) associated with this reaction  ==
+
** 196.165
* Gene: [[SJ18892]]
+
== Reaction(s) known to consume the compound ==
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-11519]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=3,7-dimethylurate}}
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}}
* [[PWY-7307]], oleate β-oxidation (reductase-dependent, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7307 PWY-7307]
+
{{#set: molecular-weight=196.165}}
** '''1''' reactions found over '''3''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=2-trans,4-trans-tetradecadienoyl-coa reductase|2,4-dienoyl-coa reductase}}
 
{{#set: ec-number=ec-1.3.1.34}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-12482

  • common-name:
    • 3,7-dimethylurate
  • smiles:
    • cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
  • inchi-key:
    • hmlzlhkhnblljd-uhfffaoysa-n
  • molecular-weight:
    • 196.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality