Difference between revisions of "N3-METHYLCYTOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17313 == * common-name: ** sapienoyl-coa * smiles: ** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o...")
(Created page with "Category:metabolite == Metabolite N3-METHYLCYTOSINE == * common-name: ** n3-methylcytosine * smiles: ** c[n+]1(c(nc=cc(n)=1)=o) * inchi-key: ** uphqqdzirihphu-uhfffaoysa-o...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17313 ==
+
== Metabolite N3-METHYLCYTOSINE ==
 
* common-name:
 
* common-name:
** sapienoyl-coa
+
** n3-methylcytosine
 
* smiles:
 
* smiles:
** cccccccccc=cccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c[n+]1(c(nc=cc(n)=1)=o)
 
* inchi-key:
 
* inchi-key:
** pvzuhjmomjkuef-hatlacbzsa-j
+
** uphqqdzirihphu-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 999.899
+
** 126.138
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-985]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16065]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sapienoyl-coa}}
+
{{#set: common-name=n3-methylcytosine}}
{{#set: inchi-key=inchikey=pvzuhjmomjkuef-hatlacbzsa-j}}
+
{{#set: inchi-key=inchikey=uphqqdzirihphu-uhfffaoysa-o}}
{{#set: molecular-weight=999.899}}
+
{{#set: molecular-weight=126.138}}

Latest revision as of 11:13, 18 March 2021

Metabolite N3-METHYLCYTOSINE

  • common-name:
    • n3-methylcytosine
  • smiles:
    • c[n+]1(c(nc=cc(n)=1)=o)
  • inchi-key:
    • uphqqdzirihphu-uhfffaoysa-o
  • molecular-weight:
    • 126.138

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality