Difference between revisions of "N4-N-ACETYL-BETA-D-GLUCOSAMINYL-F6"

Revision as of 14:59, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite ISOBUTYRYL-COA ==
+== Metabolite Cytochromes-C-Reduced ==
 * common-name:
-** isobutanoyl-coa
+** a reduced c-type cytochrome
-* smiles:
-** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
-* inchi-key:
-** aewhywspvrzhct-ndzskpawsa-j
-* molecular-weight:
-** 833.593
 == Reaction(s) known to consume the compound ==
-* [[2.3.1.168-RXN]]
+* [[1.10.2.2-RXN]]
-* [[MCDH]]
+* [[CYTOCHROME-C-OXIDASE-RXN]]
+* [[CYTOCHROME-C-PEROXIDASE-RXN]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[NITRITE-REDUCTASE-CYTOCHROME-RXN]]
+* [[RXN-15830]]
 == Reaction(s) known to produce the compound ==
-* [[1.2.1.25-RXN]]
+* [[1.10.2.2-RXN]]
-* [[2.3.1.168-RXN]]
+* [[D-LACTATE-DEHYDROGENASE-CYTOCHROME-RXN]]
-* [[DHRT_LPAREN_ibcoa_RPAREN_]]
+* [[IRON--CYTOCHROME-C-REDUCTASE-RXN]]
+* [[RXN-14107]]
+* [[RXN-15816]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=isobutanoyl-coa}}
+{{#set: common-name=a reduced c-type cytochrome}}
-{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
-{{#set: molecular-weight=833.593}}