Difference between revisions of "N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-36 == * common-name: ** 3-[(3'-methylthio)propyl]malate * smiles: ** c(c(cccsc)c(o)c(=o)[o-])(=o)[o-] * inchi-key: ** sqxviiopmysnc...") |
(Created page with "Category:metabolite == Metabolite 5-Phospho-terminated-DNAs == * common-name: ** a 5'-phospho-[dna] == Reaction(s) known to consume the compound == * [[DNA-LIGASE-ATP-RXN]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-Phospho-terminated-DNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a 5'-phospho-[dna] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DNA-LIGASE-ATP-RXN]] |
| − | * [[ | + | * [[DNA-LIGASE-NAD+-RXN]] |
| + | * [[RXN-15712]] | ||
| + | * [[RXN-15713]] | ||
| + | * [[RXN-17918]] | ||
| + | * [[RXN-17922]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[4.2.99.18-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a 5'-phospho-[dna]}} |
| − | |||
| − | |||
Revision as of 11:15, 15 January 2021
Contents
Metabolite 5-Phospho-terminated-DNAs
- common-name:
- a 5'-phospho-[dna]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a 5'-phospho-[dna" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
