Difference between revisions of "N6-L-threonylcarbamoyladenine37-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRINOGEN == * common-name: ** protoporphyrinogen ix * smiles: ** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc...")
(Created page with "Category:metabolite == Metabolite N6-L-threonylcarbamoyladenine37-tRNAs == * common-name: ** an n6-l-threonylcarbamoyladenine37 in trna == Reaction(s) known to consume the...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PROTOPORPHYRINOGEN ==
+
== Metabolite N6-L-threonylcarbamoyladenine37-tRNAs ==
 
* common-name:
 
* common-name:
** protoporphyrinogen ix
+
** an n6-l-threonylcarbamoyladenine37 in trna
* smiles:
 
** c=cc1(=c5(nc(=c1c)cc2(=c(c(=c(n2)cc3(nc(=c(c=3ccc([o-])=o)c)cc4(=c(c(=c(n4)c5)c)c=c)))ccc(=o)[o-])c)))
 
* inchi-key:
 
** uhsgpdmiqqynax-uhfffaoysa-l
 
* molecular-weight:
 
** 566.699
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PPPGO]]
 
* [[PROTOPORGENOXI-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEMN-RXN]]
+
* [[RXN-14570]]
* [[RXN0-1461]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=protoporphyrinogen ix}}
+
{{#set: common-name=an n6-l-threonylcarbamoyladenine37 in trna}}
{{#set: inchi-key=inchikey=uhsgpdmiqqynax-uhfffaoysa-l}}
 
{{#set: molecular-weight=566.699}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite N6-L-threonylcarbamoyladenine37-tRNAs

  • common-name:
    • an n6-l-threonylcarbamoyladenine37 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality