Difference between revisions of "N6N6N6-TRIMETHYL-L-LYSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Reduced-ferredoxins == * common-name: ** a reduced ferredoxin [iron-sulfur] cluster == Reaction(s) known to consume the compound == <div...") |
(Created page with "Category:metabolite == Metabolite N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](ccccc(c([o-])=o)[n+])(c)c * inchi-key: ** m...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N6N6N6-TRIMETHYL-L-LYSINE == |
* common-name: | * common-name: | ||
− | ** | + | ** n6,n6,n6-trimethyl-l-lysine |
+ | * smiles: | ||
+ | ** c[n+](ccccc(c([o-])=o)[n+])(c)c | ||
+ | * inchi-key: | ||
+ | ** mxnrlfusfkvqsk-qmmmgpobsa-o | ||
+ | * molecular-weight: | ||
+ | ** 189.277 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]] | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=n6,n6,n6-trimethyl-l-lysine}} |
+ | {{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}} | ||
+ | {{#set: molecular-weight=189.277}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite N6N6N6-TRIMETHYL-L-LYSINE
- common-name:
- n6,n6,n6-trimethyl-l-lysine
- smiles:
- c[n+](ccccc(c([o-])=o)[n+])(c)c
- inchi-key:
- mxnrlfusfkvqsk-qmmmgpobsa-o
- molecular-weight:
- 189.277