Difference between revisions of "N6N6N6-TRIMETHYL-L-LYSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...")
(Created page with "Category:metabolite == Metabolite N6N6N6-TRIMETHYL-L-LYSINE == * common-name: ** n6,n6,n6-trimethyl-l-lysine * smiles: ** c[n+](ccccc(c([o-])=o)[n+])(c)c * inchi-key: ** m...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-HISTIDINOL-P ==
+
== Metabolite N6N6N6-TRIMETHYL-L-LYSINE ==
 
* common-name:
 
* common-name:
** l-histidinol phosphate
+
** n6,n6,n6-trimethyl-l-lysine
 
* smiles:
 
* smiles:
** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
+
** c[n+](ccccc(c([o-])=o)[n+])(c)c
 
* inchi-key:
 
* inchi-key:
** cwnderhthmwbsi-yfkpbyrvsa-m
+
** mxnrlfusfkvqsk-qmmmgpobsa-o
 
* molecular-weight:
 
* molecular-weight:
** 220.144
+
** 189.277
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
* [[HISTIDPHOS-RXN]]
 
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTAMINOTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-histidinol phosphate}}
+
{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
+
{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
{{#set: molecular-weight=220.144}}
+
{{#set: molecular-weight=189.277}}

Latest revision as of 11:16, 18 March 2021

Metabolite N6N6N6-TRIMETHYL-L-LYSINE

  • common-name:
    • n6,n6,n6-trimethyl-l-lysine
  • smiles:
    • c[n+](ccccc(c([o-])=o)[n+])(c)c
  • inchi-key:
    • mxnrlfusfkvqsk-qmmmgpobsa-o
  • molecular-weight:
    • 189.277

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality