Difference between revisions of "N6N6N6-TRIMETHYL-L-LYSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Apo-EntB == * common-name: ** an apo-[entb isochorismatase/aryl-carrier protein] == Reaction(s) known to consume the compound == * ENTD...") |
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-HISTIDINOL-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-histidinol phosphate |
| + | * smiles: | ||
| + | ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) | ||
| + | * inchi-key: | ||
| + | ** cwnderhthmwbsi-yfkpbyrvsa-m | ||
| + | * molecular-weight: | ||
| + | ** 220.144 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HISTAMINOTRANS-RXN]] |
| + | * [[HISTIDPHOS-RXN]] | ||
| + | * [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HISTAMINOTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-histidinol phosphate}} |
| + | {{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}} | ||
| + | {{#set: molecular-weight=220.144}} | ||
Revision as of 14:58, 5 January 2021
Contents
Metabolite L-HISTIDINOL-P
- common-name:
- l-histidinol phosphate
- smiles:
- c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
- inchi-key:
- cwnderhthmwbsi-yfkpbyrvsa-m
- molecular-weight:
- 220.144
Reaction(s) known to consume the compound
- HISTAMINOTRANS-RXN
- HISTIDPHOS-RXN
- [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
