Difference between revisions of "N6N6N6-TRIMETHYL-L-LYSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...") |
(Created page with "Category:metabolite == Metabolite TYR-tRNAs == * common-name: ** a trnatyr == Reaction(s) known to consume the compound == * TYROSINE--TRNA-LIGASE-RXN == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite TYR-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trnatyr |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[TYROSINE--TRNA-LIGASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trnatyr}} |
| − | |||
| − | |||
Revision as of 13:11, 14 January 2021
Contents
Metabolite TYR-tRNAs
- common-name:
- a trnatyr
