Difference between revisions of "N7-methylGuanine1575-in-18StRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-661 == * common-name: ** propynoate * smiles: ** c#cc([o-])=o * inchi-key: ** uorvclmrjxcdcp-uhfffaoysa-m * molecular-weight: ** 69.0...") |
(Created page with "Category:metabolite == Metabolite CPD-12482 == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) * inchi-key: ** hmlzlhkhnblljd-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12482 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3,7-dimethylurate |
* smiles: | * smiles: | ||
| − | ** c | + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hmlzlhkhnblljd-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 196.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11519]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3,7-dimethylurate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=196.165}} |
Revision as of 14:59, 5 January 2021
Contents
Metabolite CPD-12482
- common-name:
- 3,7-dimethylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
- inchi-key:
- hmlzlhkhnblljd-uhfffaoysa-n
- molecular-weight:
- 196.165
