Difference between revisions of "N7-methylGuanine1575-in-18StRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12482 == * common-name: ** 3,7-dimethylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2)) * inchi-key: ** hmlzlhkhnblljd-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N7-Methylguanine-46 == * common-name: ** an n7-methylguanine46 in trna == Reaction(s) known to consume the compound == ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-Containing-N7-Methylguanine-46 == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n7-methylguanine46 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n7-methylguanine46 in trna}} |
| − | |||
| − | |||
Revision as of 15:30, 5 January 2021
Contents
Metabolite tRNA-Containing-N7-Methylguanine-46
- common-name:
- an n7-methylguanine46 in trna
