Difference between revisions of "NA+"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...") |
(Created page with "Category:metabolite == Metabolite NA+ == * common-name: ** na+ * smiles: ** [na+] * inchi-key: ** fknqfgjonoiptf-uhfffaoysa-n * molecular-weight: ** 22.99 == Reaction(s) k...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NA+ == |
* common-name: | * common-name: | ||
| − | ** | + | ** na+ |
* smiles: | * smiles: | ||
| − | ** | + | ** [na+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fknqfgjonoiptf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 22.99 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[3.6.3.9-RXN]] | ||
| + | * [[ExchangeSeed-NA+]] | ||
| + | * [[PINA1th]] | ||
| + | * [[PINA1tm]] | ||
| + | * [[TRANS-RXN-101]] | ||
| + | * [[TransportSeed-NA+]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.6.3.9-RXN]] |
| + | * [[ExchangeSeed-NA+]] | ||
| + | * [[PINA1th]] | ||
| + | * [[PINA1tm]] | ||
| + | * [[TRANS-RXN-101]] | ||
| + | * [[TransportSeed-NA+]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=na+}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fknqfgjonoiptf-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=22.99}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite NA+
- common-name:
- na+
- smiles:
- [na+]
- inchi-key:
- fknqfgjonoiptf-uhfffaoysa-n
- molecular-weight:
- 22.99
