Difference between revisions of "NA+"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Non-Fucosylated-Fucose-Acceptors == * common-name: ** a non fucosylated fucose acceptor == Reaction(s) known to consume the compound == =...")
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Non-Fucosylated-Fucose-Acceptors ==
+
== Metabolite RIBOSE-1P ==
 
* common-name:
 
* common-name:
** a non fucosylated fucose acceptor
+
** α-d-ribose-1-phosphate
 +
* smiles:
 +
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
 +
* inchi-key:
 +
** yxjdfqjkerbobm-txicztdvsa-l
 +
* molecular-weight:
 +
** 228.095
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ADENPHOSPHOR-RXN]]
 +
* [[INOPHOSPHOR-RXN]]
 +
* [[PNP-RXN]]
 +
* [[PPENTOMUT-RXN]]
 +
* [[RXN-14456]]
 +
* [[RXN0-5199]]
 +
* [[URPHOS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.2.1.38-RXN]]
+
* [[ADENPHOSPHOR-RXN]]
 +
* [[INOPHOSPHOR-RXN]]
 +
* [[PNP-RXN]]
 +
* [[PPENTOMUT-RXN]]
 +
* [[RXN-14456]]
 +
* [[RXN0-5199]]
 +
* [[URPHOS-RXN]]
 +
* [[XANTHOSINEPHOSPHORY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a non fucosylated fucose acceptor}}
+
{{#set: common-name=α-d-ribose-1-phosphate}}
 +
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
 +
{{#set: molecular-weight=228.095}}

Revision as of 15:26, 5 January 2021

Metabolite RIBOSE-1P

  • common-name:
    • α-d-ribose-1-phosphate
  • smiles:
    • c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
  • inchi-key:
    • yxjdfqjkerbobm-txicztdvsa-l
  • molecular-weight:
    • 228.095

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality