Difference between revisions of "NA+"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite RIBOSE-1P == * common-name: ** α-d-ribose-1-phosphate * smiles: ** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1) * inchi-key: ** yxjdfqjker...")
(Created page with "Category:metabolite == Metabolite CPD1F-453 == * common-name: ** kaempferol-3-glucoside * smiles: ** c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite RIBOSE-1P ==
+
== Metabolite CPD1F-453 ==
 
* common-name:
 
* common-name:
** α-d-ribose-1-phosphate
+
** kaempferol-3-glucoside
 
* smiles:
 
* smiles:
** c(o)c1(c(o)c(o)c(op(=o)([o-])[o-])o1)
+
** c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
 
* inchi-key:
 
* inchi-key:
** yxjdfqjkerbobm-txicztdvsa-l
+
** jpukweqwgbddqb-qsofnflrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 447.374
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPHOSPHOR-RXN]]
 
* [[INOPHOSPHOR-RXN]]
 
* [[PNP-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN-14456]]
 
* [[RXN0-5199]]
 
* [[URPHOS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENPHOSPHOR-RXN]]
+
* [[RXN1F-461]]
* [[INOPHOSPHOR-RXN]]
 
* [[PNP-RXN]]
 
* [[PPENTOMUT-RXN]]
 
* [[RXN-14456]]
 
* [[RXN0-5199]]
 
* [[URPHOS-RXN]]
 
* [[XANTHOSINEPHOSPHORY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-ribose-1-phosphate}}
+
{{#set: common-name=kaempferol-3-glucoside}}
{{#set: inchi-key=inchikey=yxjdfqjkerbobm-txicztdvsa-l}}
+
{{#set: inchi-key=inchikey=jpukweqwgbddqb-qsofnflrsa-m}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=447.374}}

Revision as of 13:09, 14 January 2021

Metabolite CPD1F-453

  • common-name:
    • kaempferol-3-glucoside
  • smiles:
    • c1(c=c(o)c=cc=1c3(oc4(c=c([o-])c=c(o)c(c(=o)c(oc2(oc(co)c(o)c(o)c(o)2))=3)=4)))
  • inchi-key:
    • jpukweqwgbddqb-qsofnflrsa-m
  • molecular-weight:
    • 447.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality