Difference between revisions of "NAD-BIOSYNTHESIS-III"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GERANYLGERANYL-PP GERANYLGERANYL-PP] ==
+== Pathway NAD-BIOSYNTHESIS-III ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** geranylgeranyl diphosphate
+** nad biosynthesis iii
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+* [[2.7.7.1-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** oinneunvozhbox-qircyjposa-k
+* [None2.4.2.12-RXN 2.4.2.12-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 447.424
+{{#set: common-name=nad biosynthesis iii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[2.5.1.32-RXN]]
+{{#set: completion rate=0.5}}
-* [[2.5.1.41-RXN]]
+{{#set: nb total reaction=2}}
-* [[2.5.1.42-RXN]]
-* [[RXN-10625]]
-* [[RXN-11486]]
-* [[RXN-11488]]
-* [[RXN-13323]]
-* [[RXN-14929]]
-* [[RXN-17480]]
-* [[RXN-3701]]
-* [[RXN-7658]]
-* [[RXN-7663]]
-* [[RXN-7673]]
-* [[RXN-8788]]
-== Reaction(s) known to produce the compound ==
-* [[FARNESYLTRANSTRANSFERASE-RXN]]
-* [[GGPS]]
-* [[RXN-3701]]
-* [[RXN-7658]]
-* [[RXN-7673]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=geranylgeranyl diphosphate}}
-{{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}
-{{#set: molecular-weight=447.424}}