Difference between revisions of "NAD-P-OR-NOP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07766 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.4.21.53-RXN ** Categ...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE == * common-name: ** 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide * smiles: ** c(op([...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE == |
| − | == | + | * common-name: |
| − | * | + | ** 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2) |
| − | ** | + | * inchi-key: |
| − | ** | + | ** abcooorlyaoboz-kqynxxcusa-l |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 364.208 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[AICARTRANSFORM-RXN]] | ||
| + | * [[FPAIF]] | ||
| + | * [[IMPCYCLOHYDROLASE-RXN]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[AICARTRANSFORM-RXN]] | ||
| + | * [[FPAIF]] | ||
| + | * [[IMPCYCLOHYDROLASE-RXN]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide}} | ||
| + | {{#set: inchi-key=inchikey=abcooorlyaoboz-kqynxxcusa-l}} | ||
| + | {{#set: molecular-weight=364.208}} | ||
Revision as of 13:07, 14 January 2021
Contents
Metabolite PHOSPHORIBOSYL-FORMAMIDO-CARBOXAMIDE
- common-name:
- 5-formamido-1-(5-phospho-d-ribosyl)-imidazole-4-carboxamide
- smiles:
- c(op([o-])(=o)[o-])c2(c(o)c(o)c(n1(c=nc(c(=o)n)=c(nc=o)1))o2)
- inchi-key:
- abcooorlyaoboz-kqynxxcusa-l
- molecular-weight:
- 364.208
