Difference between revisions of "NADH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10479 == * transcription-direction: ** negative * right-end-position: ** 219263 * left-end-position: ** 194254 * centisome-position: ** 49.95127...")
(Created page with "Category:metabolite == Metabolite CPD0-2107 == * common-name: ** (s)-3-hydroxydodecanoyl-coa * smiles: ** cccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10479 ==
+
== Metabolite CPD0-2107 ==
* transcription-direction:
+
* common-name:
** negative
+
** (s)-3-hydroxydodecanoyl-coa
* right-end-position:
+
* smiles:
** 219263
+
** cccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
* left-end-position:
+
* inchi-key:
** 194254
+
** ijflxrcjwpkgkj-lxixeqkwsa-j
* centisome-position:
+
* molecular-weight:
** 49.95127   
+
** 961.807
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ECOAH5]]
== Reaction(s) associated ==
+
* [[ECOAH5h]]
* [[PROTEIN-KINASE-RXN]]
+
* [[ECOAH5m]]
** Category: [[annotation]]
+
* [[HACD5]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[HACD5h]]
** Category: [[orthology]]
+
* [[HACD5m]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
{{#set: transcription-direction=negative}}
+
* [[ECOAH5]]
{{#set: right-end-position=219263}}
+
* [[ECOAH5h]]
{{#set: left-end-position=194254}}
+
* [[ECOAH5m]]
{{#set: centisome-position=49.95127    }}
+
* [[HACD5]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[HACD5h]]
{{#set: nb reaction associated=1}}
+
* [[HACD5m]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=(s)-3-hydroxydodecanoyl-coa}}
 +
{{#set: inchi-key=inchikey=ijflxrcjwpkgkj-lxixeqkwsa-j}}
 +
{{#set: molecular-weight=961.807}}

Revision as of 20:30, 18 December 2020

Metabolite CPD0-2107

  • common-name:
    • (s)-3-hydroxydodecanoyl-coa
  • smiles:
    • cccccccccc(o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • ijflxrcjwpkgkj-lxixeqkwsa-j
  • molecular-weight:
    • 961.807

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality