Difference between revisions of "NADH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7100 == * common-name: ** (2s)-2-isopropyl-3-oxosuccinate * smiles: ** cc(c(c(=o)[o-])c(=o)c(=o)[o-])c * inchi-key: ** hiizagqwabamrr...") |
(Created page with "Category:metabolite == Metabolite CPD-1825 == * common-name: ** β-l-arabinose 1-phosphate * smiles: ** c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-]) * inchi-key: ** ilxhfxfppzg...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-1825 == |
* common-name: | * common-name: | ||
− | ** | + | ** β-l-arabinose 1-phosphate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ilxhfxfppzgenn-qmkxcqhvsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 228.095 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[UMPU]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=β-l-arabinose 1-phosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ilxhfxfppzgenn-qmkxcqhvsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=228.095}} |
Revision as of 15:25, 5 January 2021
Contents
Metabolite CPD-1825
- common-name:
- β-l-arabinose 1-phosphate
- smiles:
- c1(oc(c(c(c1o)o)o)op([o-])(=o)[o-])
- inchi-key:
- ilxhfxfppzgenn-qmkxcqhvsa-l
- molecular-weight:
- 228.095