Difference between revisions of "NADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HYDROXY-METHYL-BUTENYL-DIP == * common-name: ** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate * smiles: ** cc(co)=ccop(op([o-])(=o)[o-]...")
(Created page with "Category:metabolite == Metabolite tRNA-precursors == * common-name: ** a trna precursor == Reaction(s) known to consume the compound == * 3.1.26.11-RXN * TRNA-CYTIDY...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite HYDROXY-METHYL-BUTENYL-DIP ==
+
== Metabolite tRNA-precursors ==
 
* common-name:
 
* common-name:
** (e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate
+
** a trna precursor
* smiles:
 
** cc(co)=ccop(op([o-])(=o)[o-])(=o)[o-]
 
* inchi-key:
 
** mdsizrkjvdmqoq-gorduthdsa-k
 
* molecular-weight:
 
** 259.069
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HDS]]
+
* [[3.1.26.11-RXN]]
* [[IDS1]]
+
* [[TRNA-CYTIDYLYLTRANSFERASE-RXN]]
* [[IDS2]]
 
* [[ISPH2-RXN]]
 
* [[RXN0-884]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HDS]]
 
* [[RXN-15878]]
 
* [[RXN0-882]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(e)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate}}
+
{{#set: common-name=a trna precursor}}
{{#set: inchi-key=inchikey=mdsizrkjvdmqoq-gorduthdsa-k}}
 
{{#set: molecular-weight=259.069}}
 

Revision as of 11:16, 15 January 2021

Metabolite tRNA-precursors

  • common-name:
    • a trna precursor

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality