Difference between revisions of "NADP"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9772 RXN-9772] == * direction: ** left-to-right * common-name: ** l-aspartate : fumarate oxidor...") |
(Created page with "Category:metabolite == Metabolite CPD-7063 == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7063 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** red chlorophyll catabolite |
− | + | * smiles: | |
− | * | + | ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o) |
− | ** | + | * inchi-key: |
− | == | + | ** gvtpycxgtfqzdt-yssugppcsa-m |
− | + | * molecular-weight: | |
− | == | + | ** 624.692 |
− | * | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-7741]] |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-7740]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=red chlorophyll catabolite}} |
− | == | + | {{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}} |
− | * | + | {{#set: molecular-weight=624.692}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− |
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-7063
- common-name:
- red chlorophyll catabolite
- smiles:
- ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
- inchi-key:
- gvtpycxgtfqzdt-yssugppcsa-m
- molecular-weight:
- 624.692