Difference between revisions of "NADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9772 RXN-9772] == * direction: ** left-to-right * common-name: ** l-aspartate : fumarate oxidor...")
(Created page with "Category:metabolite == Metabolite CPD-7063 == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9772 RXN-9772] ==
+
== Metabolite CPD-7063 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** l-aspartate : fumarate oxidoreductase (deaminating)
+
** red chlorophyll catabolite
−
** l-aspartate oxidase
+
* smiles:
−
* ec-number:
+
** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
−
** [http://enzyme.expasy.org/EC/1.5.99 ec-1.5.99]
+
* inchi-key:
−
== Reaction formula ==
+
** gvtpycxgtfqzdt-yssugppcsa-m
−
* 1 [[FUM]][c] '''+''' 1 [[L-ASPARTATE]][c] '''=>''' 1 [[IMINOASPARTATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SUC]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 624.692
−
* Gene: [[SJ19480]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
* [[RXN-7741]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
== Pathway(s) ==
+
* [[RXN-7740]]
−
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=red chlorophyll catabolite}}
−
== External links  ==
+
{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
−
* RHEA:
+
{{#set: molecular-weight=624.692}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30044 30044]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=l-aspartate : fumarate oxidoreductase (deaminating)|l-aspartate oxidase}}
 
−
{{#set: ec-number=ec-1.5.99}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:34, 18 December 2020

Metabolite CPD-7063

  • common-name:
    • red chlorophyll catabolite
  • smiles:
    • ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
  • inchi-key:
    • gvtpycxgtfqzdt-yssugppcsa-m
  • molecular-weight:
    • 624.692

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=NADP&oldid=47123"