Difference between revisions of "NADPH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9699 == * common-name: ** hypoglycin a * smiles: ** c=c1(c(cc([n+])c([o-])=o)c1) * inchi-key: ** oojzcxfxpzgubj-uhfffaoysa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-6991 == * common-name: ** (2s)-pinocembrin * smiles: ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) * inchi-key: ** urfcjeuyxna...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-6991 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s)-pinocembrin |
* smiles: | * smiles: | ||
| − | ** c= | + | ** c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** urfcjeuyxnahfi-zdusscgksa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.249 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-7648]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7647]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s)-pinocembrin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=urfcjeuyxnahfi-zdusscgksa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.249}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-6991
- common-name:
- (2s)-pinocembrin
- smiles:
- c3(c=cc(c2(oc1(=cc(=cc(=c1c(c2)=o)o)[o-])))=cc=3)
- inchi-key:
- urfcjeuyxnahfi-zdusscgksa-m
- molecular-weight:
- 255.249
