Difference between revisions of "NADPHOS-DEPHOS-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] == * common-name: ** s-(2-methylpropanoyl)-dihydrolipoamide * smiles: ** cc(c(...")
(Created page with "Category:pathway == Pathway PWY-6603 == * taxonomic-range: ** tax-3208 * common-name: ** dicranin biosynthesis == Reaction(s) found == * RXN-11680 * RXN-11681 * ...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-281 CPD-281] ==
+
== Pathway PWY-6603 ==
 +
* taxonomic-range:
 +
** tax-3208
 
* common-name:
 
* common-name:
−
** s-(2-methylpropanoyl)-dihydrolipoamide
+
** dicranin biosynthesis
−
* smiles:
+
== Reaction(s) found ==
−
** cc(c(sc(ccccc(n)=o)ccs)=o)c
+
* [[RXN-11680]]
−
* inchi-key:
+
* [[RXN-11681]]
−
** xzukurpvwdtxge-uhfffaoysa-n
+
* [[RXN-11682]]
−
* molecular-weight:
+
* [[RXN-8347]]
−
** 277.439
+
== Reaction(s) not found ==
−
== Reaction(s) known to consume the compound ==
+
All reactions of this pathways are in present
−
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
+
{{#set: taxonomic-range=tax-3208}}
−
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=dicranin biosynthesis}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=4}}
−
{{#set: common-name=s-(2-methylpropanoyl)-dihydrolipoamide}}
+
{{#set: completion rate=1.0}}
−
{{#set: inchi-key=inchikey=xzukurpvwdtxge-uhfffaoysa-n}}
+
{{#set: nb total reaction=4}}
−
{{#set: molecular-weight=277.439}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-6603

  • taxonomic-range:
    • tax-3208
  • common-name:
    • dicranin biosynthesis

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=NADPHOS-DEPHOS-PWY&oldid=40371"