Difference between revisions of "NARINGENIN-CMPD"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BIOMASS == == Reaction(s) known to consume the compound == * Exchange_BIOMASS * Transport_BIOMASS == Reaction(s) known to produce...") |
(Created page with "Category:metabolite == Metabolite NARINGENIN-CMPD == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) * inchi-key: ** ftv...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite NARINGENIN-CMPD == |
| + | * common-name: | ||
| + | ** (2s)-naringenin | ||
| + | * smiles: | ||
| + | ** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o) | ||
| + | * inchi-key: | ||
| + | ** ftvwirxfelqlpi-zdusscgksa-n | ||
| + | * molecular-weight: | ||
| + | ** 272.257 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NARINGENIN-3-DIOXYGENASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[APIGNAR-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=(2s)-naringenin}} | ||
| + | {{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}} | ||
| + | {{#set: molecular-weight=272.257}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite NARINGENIN-CMPD
- common-name:
- (2s)-naringenin
- smiles:
- c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
- inchi-key:
- ftvwirxfelqlpi-zdusscgksa-n
- molecular-weight:
- 272.257
