Difference between revisions of "NIACINAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** ybisuhxejdgad...") |
(Created page with "Category:metabolite == Metabolite NIACINAMIDE == * common-name: ** nicotinamide * smiles: ** c1(n=cc(c(=o)n)=cc=1) * inchi-key: ** dfpaksucgfbddf-uhfffaoysa-n * molecular-...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite NIACINAMIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** nicotinamide |
* smiles: | * smiles: | ||
− | ** | + | ** c1(n=cc(c(=o)n)=cc=1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** dfpaksucgfbddf-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 122.126 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.4.2.31-RXN]] |
− | * [[ | + | * [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] |
+ | * [[NICOTINAMIDE-N-METHYLTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2.4.2.31-RXN]] |
+ | * [[2.7.1.160-RXN]] | ||
+ | * [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=nicotinamide}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dfpaksucgfbddf-uhfffaoysa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=122.126}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite NIACINAMIDE
- common-name:
- nicotinamide
- smiles:
- c1(n=cc(c(=o)n)=cc=1)
- inchi-key:
- dfpaksucgfbddf-uhfffaoysa-n
- molecular-weight:
- 122.126