Difference between revisions of "NIACINAMIDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20230 == * transcription-direction: ** negative * right-end-position: ** 145572 * left-end-position: ** 115658 * centisome-position: ** 54.763092...") |
(Created page with "Category:metabolite == Metabolite CPDQT-38 == * common-name: ** 3-[(5'-methylthio)pentyl]malate * smiles: ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** ybisuhxejdgad...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPDQT-38 == |
| − | * | + | * common-name: |
| − | ** | + | ** 3-[(5'-methylthio)pentyl]malate |
| − | * | + | * smiles: |
| − | ** | + | ** cscccccc(c(o)c(=o)[o-])c(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** ybisuhxejdgadq-uhfffaoysa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 248.293 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-18204]] |
| − | == Reaction(s) | + | * [[RXNQT-4171]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-18204]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=3-[(5'-methylthio)pentyl]malate}} | |
| − | + | {{#set: inchi-key=inchikey=ybisuhxejdgadq-uhfffaoysa-l}} | |
| − | {{#set: | + | {{#set: molecular-weight=248.293}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:35, 18 December 2020
Contents
Metabolite CPDQT-38
- common-name:
- 3-[(5'-methylthio)pentyl]malate
- smiles:
- cscccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- ybisuhxejdgadq-uhfffaoysa-l
- molecular-weight:
- 248.293
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(5'-methylthio)pentyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
